C12H24NO4P — CID 142105704
[(E)-2,5-dimethyl-6-(2-methylpropanoylamino)hex-1-enyl]phosphonic acid (PubChem CID 142105704) has the molecular formula C12H24NO4P and a molecular weight of 277.30 g/mol. Its IUPAC name is [(E)-2,5-dimethyl-6-(2-methylpropanoylamino)hex-1-enyl]phosphonic acid.
| Compound Name | [(E)-2,5-dimethyl-6-(2-methylpropanoylamino)hex-1-enyl]phosphonic acid |
|---|---|
| PubChem CID | 142105704 |
| Molecular Formula | C12H24NO4P |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | [(E)-2,5-dimethyl-6-(2-methylpropanoylamino)hex-1-enyl]phosphonic acid |
| SMILES | C/C(=C\P(=O)(O)O)CCC(C)CNC(=O)C(C)C |
| InChI | InChI=1S/C12H24NO4P/c1-9(2)12(14)13-7-10(3)5-6-11(4)8-18(15,16)17/h8-10H,5-7H2,1-4H3,(H,13,14)(H2,15,16,17)/b11-8+ |
| InChIKey | VRBKXFOHOXVCLS-DHZHZOJOSA-N |
| XLogP | 2.26 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|