C22H25N — CID 142106669
2-[4-[3-(2-phenylethyl)phenyl]butyl]-1H-pyrrole (PubChem CID 142106669) has the molecular formula C22H25N and a molecular weight of 303.45 g/mol. Its IUPAC name is 2-[4-[3-(2-phenylethyl)phenyl]butyl]-1H-pyrrole.
| Compound Name | 2-[4-[3-(2-phenylethyl)phenyl]butyl]-1H-pyrrole |
|---|---|
| PubChem CID | 142106669 |
| Molecular Formula | C22H25N |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 2-[4-[3-(2-phenylethyl)phenyl]butyl]-1H-pyrrole |
| SMILES | c1ccc(CCc2cccc(CCCCc3ccc[nH]3)c2)cc1 |
| InChI | InChI=1S/C22H25N/c1-2-8-19(9-3-1)15-16-21-12-6-11-20(18-21)10-4-5-13-22-14-7-17-23-22/h1-3,6-9,11-12,14,17-18,23H,4-5,10,13,15-16H2 |
| InChIKey | HYNQIRZUVKKIKF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|