C16H21NO — CID 142106754
spiro[3,5-dihydro-1H-2-benzazepine-4,3'-cyclohexene]-2-ylmethanol (PubChem CID 142106754) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is spiro[3,5-dihydro-1H-2-benzazepine-4,3'-cyclohexene]-2-ylmethanol.
| Compound Name | spiro[3,5-dihydro-1H-2-benzazepine-4,3'-cyclohexene]-2-ylmethanol |
|---|---|
| PubChem CID | 142106754 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | spiro[3,5-dihydro-1H-2-benzazepine-4,3'-cyclohexene]-2-ylmethanol |
| SMILES | OCN1Cc2ccccc2CC2(C=CCCC2)C1 |
| InChI | InChI=1S/C16H21NO/c18-13-17-11-15-7-3-2-6-14(15)10-16(12-17)8-4-1-5-9-16/h2-4,6-8,18H,1,5,9-13H2 |
| InChIKey | QCKDKFIVWVWUBW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|