About 2-[(1-fluorocyclopropyl)methyl]-1,3-dihydroisoindole
2-[(1-fluorocyclopropyl)methyl]-1,3-dihydroisoindole (PubChem CID 175938518) has the molecular formula C12H14FN
and a molecular weight of 191.25 g/mol. Its IUPAC name is 2-[(1-fluorocyclopropyl)methyl]-1,3-dihydroisoindole.
Analyze 2-[(1-fluorocyclopropyl)methyl]-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-fluorocyclopropyl)methyl]-1,3-dihydroisoindole?
The IUPAC name of 2-[(1-fluorocyclopropyl)methyl]-1,3-dihydroisoindole (CID 175938518) is 2-[(1-fluorocyclopropyl)methyl]-1,3-dihydroisoindole.
What is the SMILES notation for 2-[(1-fluorocyclopropyl)methyl]-1,3-dihydroisoindole?
The canonical SMILES for 2-[(1-fluorocyclopropyl)methyl]-1,3-dihydroisoindole is FC1(CN2Cc3ccccc3C2)CC1.
What is the InChIKey of 2-[(1-fluorocyclopropyl)methyl]-1,3-dihydroisoindole?
The InChIKey is OVABZFKEPIHWTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FN/c13-12(5-6-12)9-14-7-10-3-1-2-4-11(10)8-14/h1-4H,5-9H2.
What are the key properties of 2-[(1-fluorocyclopropyl)methyl]-1,3-dihydroisoindole?
2-[(1-fluorocyclopropyl)methyl]-1,3-dihydroisoindole has a molecular weight of 191.25 g/mol, XLogP of 2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-fluorocyclopropyl)methyl]-1,3-dihydroisoindole is sourced from PubChem (CID 175938518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).