About ethane;methyl 4-[4-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]-3-methylbutanoate
ethane;methyl 4-[4-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]-3-methylbutanoate (PubChem CID 142107029) has the molecular formula C15H26N4O2
and a molecular weight of 294.40 g/mol. Its IUPAC name is ethane;methyl 4-[4-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]-3-methylbutanoate.
Molecular Properties
| Compound Name | ethane;methyl 4-[4-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]-3-methylbutanoate |
| PubChem CID | 142107029 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | ethane;methyl 4-[4-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]-3-methylbutanoate |
| SMILES | CC.COC(=O)CC(C)Cc1ccc(/C(N)=N/NN)cc1 |
| InChI | InChI=1S/C13H20N4O2.C2H6/c1-9(8-12(18)19-2)7-10-3-5-11(6-4-10)13(14)16-17-15;1-2/h3-6,9,17H,7-8,15H2,1-2H3,(H2,14,16);1-2H3 |
| InChIKey | OGXAQBXCZNQLTA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl 4-[4-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 4-[4-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]-3-methylbutanoate?
The IUPAC name of ethane;methyl 4-[4-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]-3-methylbutanoate (CID 142107029) is ethane;methyl 4-[4-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]-3-methylbutanoate.
What is the SMILES notation for ethane;methyl 4-[4-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]-3-methylbutanoate?
The canonical SMILES for ethane;methyl 4-[4-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]-3-methylbutanoate is CC.COC(=O)CC(C)Cc1ccc(/C(N)=N/NN)cc1.
What is the InChIKey of ethane;methyl 4-[4-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]-3-methylbutanoate?
The InChIKey is OGXAQBXCZNQLTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O2.C2H6/c1-9(8-12(18)19-2)7-10-3-5-11(6-4-10)13(14)16-17-15;1-2/h3-6,9,17H,7-8,15H2,1-2H3,(H2,14,16);1-2H3.
What are the key properties of ethane;methyl 4-[4-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]-3-methylbutanoate?
ethane;methyl 4-[4-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]-3-methylbutanoate has a molecular weight of 294.40 g/mol, XLogP of 1.54, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 4-[4-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]-3-methylbutanoate is sourced from PubChem (CID 142107029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).