C13H11FN2O3 — CID 142107606
5-(2-amino-4-fluoro-3-prop-1-en-2-ylphenyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 142107606) has the molecular formula C13H11FN2O3 and a molecular weight of 262.24 g/mol. Its IUPAC name is 5-(2-amino-4-fluoro-3-prop-1-en-2-ylphenyl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(2-amino-4-fluoro-3-prop-1-en-2-ylphenyl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 142107606 |
| Molecular Formula | C13H11FN2O3 |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 5-(2-amino-4-fluoro-3-prop-1-en-2-ylphenyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | C=C(C)c1c(F)ccc(-c2cc(C(=O)O)no2)c1N |
| InChI | InChI=1S/C13H11FN2O3/c1-6(2)11-8(14)4-3-7(12(11)15)10-5-9(13(17)18)16-19-10/h3-5H,1,15H2,2H3,(H,17,18) |
| InChIKey | ZXRSMDJVVXCFMN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|