C16H12F3N3OS — CID 142108640
4-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfinamide (PubChem CID 142108640) has the molecular formula C16H12F3N3OS and a molecular weight of 351.35 g/mol. Its IUPAC name is 4-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfinamide.
| Compound Name | 4-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfinamide |
|---|---|
| PubChem CID | 142108640 |
| Molecular Formula | C16H12F3N3OS |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 4-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfinamide |
| SMILES | NS(=O)c1ccc(-n2nc(C(F)(F)F)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H12F3N3OS/c17-16(18,19)15-10-14(11-4-2-1-3-5-11)22(21-15)12-6-8-13(9-7-12)24(20)23/h1-10H,20H2 |
| InChIKey | OKTLJJWAWIZVNW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |