C18H16F3N3O2S — CID 163477507
4-[1-[4-[(E)-amino(1-hydroxyethylidene)-λ4-sulfanyl]phenyl]-3-(trifluoromethyl)pyrazol-5-yl]phenol (PubChem CID 163477507) has the molecular formula C18H16F3N3O2S and a molecular weight of 395.41 g/mol. Its IUPAC name is 4-[1-[4-[(E)-amino(1-hydroxyethylidene)-λ4-sulfanyl]phenyl]-3-(trifluoromethyl)pyrazol-5-yl]phenol.
| Compound Name | 4-[1-[4-[(E)-amino(1-hydroxyethylidene)-λ4-sulfanyl]phenyl]-3-(trifluoromethyl)pyrazol-5-yl]phenol |
|---|---|
| PubChem CID | 163477507 |
| Molecular Formula | C18H16F3N3O2S |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 4-[1-[4-[(E)-amino(1-hydroxyethylidene)-λ4-sulfanyl]phenyl]-3-(trifluoromethyl)pyrazol-5-yl]phenol |
| SMILES | C/C(O)=S(\N)c1ccc(-n2nc(C(F)(F)F)cc2-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C18H16F3N3O2S/c1-11(25)27(22)15-8-4-13(5-9-15)24-16(10-17(23-24)18(19,20)21)12-2-6-14(26)7-3-12/h2-10,25-26H,22H2,1H3 |
| InChIKey | CBSFFDLCXFOBSS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|