C21H23NO4 — CID 142109066
(5R)-5-amino-1-[[(2S)-oxiran-2-yl]methoxy]-4-phenylmethoxy-5,6,8,9-tetrahydrobenzo[7]annulen-7-one (PubChem CID 142109066) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is (5R)-5-amino-1-[[(2S)-oxiran-2-yl]methoxy]-4-phenylmethoxy-5,6,8,9-tetrahydrobenzo[7]annulen-7-one.
| Compound Name | (5R)-5-amino-1-[[(2S)-oxiran-2-yl]methoxy]-4-phenylmethoxy-5,6,8,9-tetrahydrobenzo[7]annulen-7-one |
|---|---|
| PubChem CID | 142109066 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (5R)-5-amino-1-[[(2S)-oxiran-2-yl]methoxy]-4-phenylmethoxy-5,6,8,9-tetrahydrobenzo[7]annulen-7-one |
| SMILES | N[C@@H]1CC(=O)CCc2c(OC[C@@H]3CO3)ccc(OCc3ccccc3)c21 |
| InChI | InChI=1S/C21H23NO4/c22-18-10-15(23)6-7-17-19(26-13-16-12-24-16)8-9-20(21(17)18)25-11-14-4-2-1-3-5-14/h1-5,8-9,16,18H,6-7,10-13,22H2/t16-,18+/m0/s1 |
| InChIKey | ONFLWNLVNGZMRS-FUHWJXTLSA-N |
| XLogP | 2.95 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|