C25H32N2O3S — CID 142109274
4-hydroxybutyl (E)-N-ethyl-2-(4-methylphenyl)-3-[[(E)-2-phenylethenyl]sulfinylamino]but-2-enimidate (PubChem CID 142109274) has the molecular formula C25H32N2O3S and a molecular weight of 440.61 g/mol. Its IUPAC name is 4-hydroxybutyl (E)-N-ethyl-2-(4-methylphenyl)-3-[[(E)-2-phenylethenyl]sulfinylamino]but-2-enimidate.
| Compound Name | 4-hydroxybutyl (E)-N-ethyl-2-(4-methylphenyl)-3-[[(E)-2-phenylethenyl]sulfinylamino]but-2-enimidate |
|---|---|
| PubChem CID | 142109274 |
| Molecular Formula | C25H32N2O3S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 4-hydroxybutyl (E)-N-ethyl-2-(4-methylphenyl)-3-[[(E)-2-phenylethenyl]sulfinylamino]but-2-enimidate |
| SMILES | CC/N=C(OCCCCO)/C(=C(\C)NS(=O)/C=C/c1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H32N2O3S/c1-4-26-25(30-18-9-8-17-28)24(23-14-12-20(2)13-15-23)21(3)27-31(29)19-16-22-10-6-5-7-11-22/h5-7,10-16,19,27-28H,4,8-9,17-18H2,1-3H3/b19-16+,24-21+,26-25- |
| InChIKey | BTVKSOJOZIPYQY-QQIPIGDMSA-N |
| XLogP | 4.86 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|