About 1-(4-hydroxybutoxy)ethyl (E)-3-phenylprop-2-enoate
1-(4-hydroxybutoxy)ethyl (E)-3-phenylprop-2-enoate (PubChem CID 143811808) has the molecular formula C15H20O4
and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-(4-hydroxybutoxy)ethyl (E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | 1-(4-hydroxybutoxy)ethyl (E)-3-phenylprop-2-enoate |
| PubChem CID | 143811808 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 1-(4-hydroxybutoxy)ethyl (E)-3-phenylprop-2-enoate |
| SMILES | CC(OCCCCO)OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H20O4/c1-13(18-12-6-5-11-16)19-15(17)10-9-14-7-3-2-4-8-14/h2-4,7-10,13,16H,5-6,11-12H2,1H3/b10-9+ |
| InChIKey | IHGVAOIFVJAYKJ-MDZDMXLPSA-N |
| XLogP | 2.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-hydroxybutoxy)ethyl (E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-hydroxybutoxy)ethyl (E)-3-phenylprop-2-enoate?
The IUPAC name of 1-(4-hydroxybutoxy)ethyl (E)-3-phenylprop-2-enoate (CID 143811808) is 1-(4-hydroxybutoxy)ethyl (E)-3-phenylprop-2-enoate.
What is the SMILES notation for 1-(4-hydroxybutoxy)ethyl (E)-3-phenylprop-2-enoate?
The canonical SMILES for 1-(4-hydroxybutoxy)ethyl (E)-3-phenylprop-2-enoate is CC(OCCCCO)OC(=O)/C=C/c1ccccc1.
What is the InChIKey of 1-(4-hydroxybutoxy)ethyl (E)-3-phenylprop-2-enoate?
The InChIKey is IHGVAOIFVJAYKJ-MDZDMXLPSA-N. The full InChI is InChI=1S/C15H20O4/c1-13(18-12-6-5-11-16)19-15(17)10-9-14-7-3-2-4-8-14/h2-4,7-10,13,16H,5-6,11-12H2,1H3/b10-9+.
What are the key properties of 1-(4-hydroxybutoxy)ethyl (E)-3-phenylprop-2-enoate?
1-(4-hydroxybutoxy)ethyl (E)-3-phenylprop-2-enoate has a molecular weight of 264.32 g/mol, XLogP of 2.38, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-hydroxybutoxy)ethyl (E)-3-phenylprop-2-enoate is sourced from PubChem (CID 143811808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).