C28H35NO7 — CID 89174464
1-[4-[1-[(E)-3-phenylprop-2-enoyl]oxyethoxy]butoxy]ethyl 2-(2,4-dihydro-1,3-benzoxazin-3-yl)propanoate (PubChem CID 89174464) has the molecular formula C28H35NO7 and a molecular weight of 497.59 g/mol. Its IUPAC name is 1-[4-[1-[(E)-3-phenylprop-2-enoyl]oxyethoxy]butoxy]ethyl 2-(2,4-dihydro-1,3-benzoxazin-3-yl)propanoate.
| Compound Name | 1-[4-[1-[(E)-3-phenylprop-2-enoyl]oxyethoxy]butoxy]ethyl 2-(2,4-dihydro-1,3-benzoxazin-3-yl)propanoate |
|---|---|
| PubChem CID | 89174464 |
| Molecular Formula | C28H35NO7 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 1-[4-[1-[(E)-3-phenylprop-2-enoyl]oxyethoxy]butoxy]ethyl 2-(2,4-dihydro-1,3-benzoxazin-3-yl)propanoate |
| SMILES | CC(OCCCCOC(C)OC(=O)C(C)N1COc2ccccc2C1)OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C28H35NO7/c1-21(29-19-25-13-7-8-14-26(25)34-20-29)28(31)36-23(3)33-18-10-9-17-32-22(2)35-27(30)16-15-24-11-5-4-6-12-24/h4-8,11-16,21-23H,9-10,17-20H2,1-3H3/b16-15+ |
| InChIKey | UEGMYOUBXQIBNJ-FOCLMDBBSA-N |
| XLogP | 4.53 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|