C17H27NO5 — CID 143811804
1-(4-hydroxybutoxy)ethyl 2-[5,6-bis(ethenyl)-2,4-dihydro-1,3-oxazin-3-yl]propanoate (PubChem CID 143811804) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-(4-hydroxybutoxy)ethyl 2-[5,6-bis(ethenyl)-2,4-dihydro-1,3-oxazin-3-yl]propanoate.
| Compound Name | 1-(4-hydroxybutoxy)ethyl 2-[5,6-bis(ethenyl)-2,4-dihydro-1,3-oxazin-3-yl]propanoate |
|---|---|
| PubChem CID | 143811804 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 1-(4-hydroxybutoxy)ethyl 2-[5,6-bis(ethenyl)-2,4-dihydro-1,3-oxazin-3-yl]propanoate |
| SMILES | C=CC1=C(C=C)OCN(C(C)C(=O)OC(C)OCCCCO)C1 |
| InChI | InChI=1S/C17H27NO5/c1-5-15-11-18(12-22-16(15)6-2)13(3)17(20)23-14(4)21-10-8-7-9-19/h5-6,13-14,19H,1-2,7-12H2,3-4H3 |
| InChIKey | GFOLLJMJGYOWHZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|