About 8-hydroxyoctyl 3-phenylprop-2-eneperoxoate
8-hydroxyoctyl 3-phenylprop-2-eneperoxoate (PubChem CID 150010433) has the molecular formula C17H24O4
and a molecular weight of 292.38 g/mol. Its IUPAC name is 8-hydroxyoctyl 3-phenylprop-2-eneperoxoate.
Molecular Properties
| Compound Name | 8-hydroxyoctyl 3-phenylprop-2-eneperoxoate |
| PubChem CID | 150010433 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 8-hydroxyoctyl 3-phenylprop-2-eneperoxoate |
| SMILES | O=C(C=Cc1ccccc1)OOCCCCCCCCO |
| InChI | InChI=1S/C17H24O4/c18-14-8-3-1-2-4-9-15-20-21-17(19)13-12-16-10-6-5-7-11-16/h5-7,10-13,18H,1-4,8-9,14-15H2 |
| InChIKey | DDDVKCDXGLQYFU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 8-hydroxyoctyl 3-phenylprop-2-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxyoctyl 3-phenylprop-2-eneperoxoate?
The IUPAC name of 8-hydroxyoctyl 3-phenylprop-2-eneperoxoate (CID 150010433) is 8-hydroxyoctyl 3-phenylprop-2-eneperoxoate.
What is the SMILES notation for 8-hydroxyoctyl 3-phenylprop-2-eneperoxoate?
The canonical SMILES for 8-hydroxyoctyl 3-phenylprop-2-eneperoxoate is O=C(C=Cc1ccccc1)OOCCCCCCCCO.
What is the InChIKey of 8-hydroxyoctyl 3-phenylprop-2-eneperoxoate?
The InChIKey is DDDVKCDXGLQYFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O4/c18-14-8-3-1-2-4-9-15-20-21-17(19)13-12-16-10-6-5-7-11-16/h5-7,10-13,18H,1-4,8-9,14-15H2.
What are the key properties of 8-hydroxyoctyl 3-phenylprop-2-eneperoxoate?
8-hydroxyoctyl 3-phenylprop-2-eneperoxoate has a molecular weight of 292.38 g/mol, XLogP of 3.51, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxyoctyl 3-phenylprop-2-eneperoxoate is sourced from PubChem (CID 150010433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).