About bis(3-hydroxypropyl) (E)-2-phenylbut-2-enediperoxoate
bis(3-hydroxypropyl) (E)-2-phenylbut-2-enediperoxoate (PubChem CID 88841429) has the molecular formula C16H20O8
and a molecular weight of 340.33 g/mol. Its IUPAC name is bis(3-hydroxypropyl) (E)-2-phenylbut-2-enediperoxoate.
Molecular Properties
| Compound Name | bis(3-hydroxypropyl) (E)-2-phenylbut-2-enediperoxoate |
| PubChem CID | 88841429 |
| Molecular Formula | C16H20O8 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | bis(3-hydroxypropyl) (E)-2-phenylbut-2-enediperoxoate |
| SMILES | O=C(/C=C(/C(=O)OOCCCO)c1ccccc1)OOCCCO |
| InChI | InChI=1S/C16H20O8/c17-8-4-10-21-23-15(19)12-14(13-6-2-1-3-7-13)16(20)24-22-11-5-9-18/h1-3,6-7,12,17-18H,4-5,8-11H2/b14-12+ |
| InChIKey | VTVSVSWMTGILTQ-WYMLVPIESA-N |
| XLogP | 0.78 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze bis(3-hydroxypropyl) (E)-2-phenylbut-2-enediperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-hydroxypropyl) (E)-2-phenylbut-2-enediperoxoate?
The IUPAC name of bis(3-hydroxypropyl) (E)-2-phenylbut-2-enediperoxoate (CID 88841429) is bis(3-hydroxypropyl) (E)-2-phenylbut-2-enediperoxoate.
What is the SMILES notation for bis(3-hydroxypropyl) (E)-2-phenylbut-2-enediperoxoate?
The canonical SMILES for bis(3-hydroxypropyl) (E)-2-phenylbut-2-enediperoxoate is O=C(/C=C(/C(=O)OOCCCO)c1ccccc1)OOCCCO.
What is the InChIKey of bis(3-hydroxypropyl) (E)-2-phenylbut-2-enediperoxoate?
The InChIKey is VTVSVSWMTGILTQ-WYMLVPIESA-N. The full InChI is InChI=1S/C16H20O8/c17-8-4-10-21-23-15(19)12-14(13-6-2-1-3-7-13)16(20)24-22-11-5-9-18/h1-3,6-7,12,17-18H,4-5,8-11H2/b14-12+.
What are the key properties of bis(3-hydroxypropyl) (E)-2-phenylbut-2-enediperoxoate?
bis(3-hydroxypropyl) (E)-2-phenylbut-2-enediperoxoate has a molecular weight of 340.33 g/mol, XLogP of 0.78, 11 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-hydroxypropyl) (E)-2-phenylbut-2-enediperoxoate is sourced from PubChem (CID 88841429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).