C23H27N4O2P — CID 142109344
1,3-dimethyl-N-[2-[4-[(E)-C-methyl-N-propoxycarbonimidoyl]phenyl]phenyl]-5-phosphanylpyrazole-4-carboxamide (PubChem CID 142109344) has the molecular formula C23H27N4O2P and a molecular weight of 422.47 g/mol. Its IUPAC name is 1,3-dimethyl-N-[2-[4-[(E)-C-methyl-N-propoxycarbonimidoyl]phenyl]phenyl]-5-phosphanylpyrazole-4-carboxamide.
| Compound Name | 1,3-dimethyl-N-[2-[4-[(E)-C-methyl-N-propoxycarbonimidoyl]phenyl]phenyl]-5-phosphanylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 142109344 |
| Molecular Formula | C23H27N4O2P |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 1,3-dimethyl-N-[2-[4-[(E)-C-methyl-N-propoxycarbonimidoyl]phenyl]phenyl]-5-phosphanylpyrazole-4-carboxamide |
| SMILES | CCCO/N=C(\C)c1ccc(-c2ccccc2NC(=O)c2c(C)nn(C)c2P)cc1 |
| InChI | InChI=1S/C23H27N4O2P/c1-5-14-29-26-15(2)17-10-12-18(13-11-17)19-8-6-7-9-20(19)24-22(28)21-16(3)25-27(4)23(21)30/h6-13H,5,14,30H2,1-4H3,(H,24,28)/b26-15+ |
| InChIKey | HBSAHICEQIEKCL-CVKSISIWSA-N |
| XLogP | 4.30 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|