C26H23FN4O2 — CID 74067736
5-fluoro-1,3-dimethyl-N-[2-[4-(phenylmethoxyiminomethyl)phenyl]phenyl]pyrazole-4-carboxamide (PubChem CID 74067736) has the molecular formula C26H23FN4O2 and a molecular weight of 442.49 g/mol. Its IUPAC name is 5-fluoro-1,3-dimethyl-N-[2-[4-(phenylmethoxyiminomethyl)phenyl]phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-fluoro-1,3-dimethyl-N-[2-[4-(phenylmethoxyiminomethyl)phenyl]phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 74067736 |
| Molecular Formula | C26H23FN4O2 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 5-fluoro-1,3-dimethyl-N-[2-[4-(phenylmethoxyiminomethyl)phenyl]phenyl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(F)c1C(=O)Nc1ccccc1-c1ccc(C=NOCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H23FN4O2/c1-18-24(25(27)31(2)30-18)26(32)29-23-11-7-6-10-22(23)21-14-12-19(13-15-21)16-28-33-17-20-8-4-3-5-9-20/h3-16H,17H2,1-2H3,(H,29,32) |
| InChIKey | DCUWRPBEQXXAPR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|