C25H22FN5O2 — CID 23593921
5-fluoro-1,3-dimethyl-N-[2-[4-[(E)-pyridin-2-ylmethoxyiminomethyl]phenyl]phenyl]pyrazole-4-carboxamide (PubChem CID 23593921) has the molecular formula C25H22FN5O2 and a molecular weight of 443.48 g/mol. Its IUPAC name is 5-fluoro-1,3-dimethyl-N-[2-[4-[(E)-pyridin-2-ylmethoxyiminomethyl]phenyl]phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-fluoro-1,3-dimethyl-N-[2-[4-[(E)-pyridin-2-ylmethoxyiminomethyl]phenyl]phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 23593921 |
| Molecular Formula | C25H22FN5O2 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 5-fluoro-1,3-dimethyl-N-[2-[4-[(E)-pyridin-2-ylmethoxyiminomethyl]phenyl]phenyl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(F)c1C(=O)Nc1ccccc1-c1ccc(/C=N/OCc2ccccn2)cc1 |
| InChI | InChI=1S/C25H22FN5O2/c1-17-23(24(26)31(2)30-17)25(32)29-22-9-4-3-8-21(22)19-12-10-18(11-13-19)15-28-33-16-20-7-5-6-14-27-20/h3-15H,16H2,1-2H3,(H,29,32)/b28-15+ |
| InChIKey | XZGAUKNBBGBVIJ-RWPZCVJISA-N |
| XLogP | 4.73 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|