C14H12F5N3O2 — CID 87475107
5-fluoro-1,3-dimethyl-N-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrazole-4-carboxamide (PubChem CID 87475107) has the molecular formula C14H12F5N3O2 and a molecular weight of 349.26 g/mol. Its IUPAC name is 5-fluoro-1,3-dimethyl-N-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-fluoro-1,3-dimethyl-N-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 87475107 |
| Molecular Formula | C14H12F5N3O2 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 5-fluoro-1,3-dimethyl-N-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(F)c1C(=O)Nc1ccccc1OC(F)(F)C(F)F |
| InChI | InChI=1S/C14H12F5N3O2/c1-7-10(11(15)22(2)21-7)12(23)20-8-5-3-4-6-9(8)24-14(18,19)13(16)17/h3-6,13H,1-2H3,(H,20,23) |
| InChIKey | IORQPBGRACPGSN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|