C15H12F6N2O2 — CID 91613425
4-(difluoromethyl)-1-methyl-N-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrrole-3-carboxamide (PubChem CID 91613425) has the molecular formula C15H12F6N2O2 and a molecular weight of 366.26 g/mol. Its IUPAC name is 4-(difluoromethyl)-1-methyl-N-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrrole-3-carboxamide.
| Compound Name | 4-(difluoromethyl)-1-methyl-N-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 91613425 |
| Molecular Formula | C15H12F6N2O2 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 4-(difluoromethyl)-1-methyl-N-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrrole-3-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2ccccc2OC(F)(F)C(F)F)c(C(F)F)c1 |
| InChI | InChI=1S/C15H12F6N2O2/c1-23-6-8(12(16)17)9(7-23)13(24)22-10-4-2-3-5-11(10)25-15(20,21)14(18)19/h2-7,12,14H,1H3,(H,22,24) |
| InChIKey | VCUAHGIIXJVCBM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|