C17H12F4N2O5 — CID 118626163
3-carbamoyl-4-[[2-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamoyl]benzoic acid (PubChem CID 118626163) has the molecular formula C17H12F4N2O5 and a molecular weight of 400.28 g/mol. Its IUPAC name is 3-carbamoyl-4-[[2-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamoyl]benzoic acid.
| Compound Name | 3-carbamoyl-4-[[2-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 118626163 |
| Molecular Formula | C17H12F4N2O5 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 3-carbamoyl-4-[[2-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamoyl]benzoic acid |
| SMILES | NC(=O)c1cc(C(=O)O)ccc1C(=O)Nc1ccccc1OC(F)(F)C(F)F |
| InChI | InChI=1S/C17H12F4N2O5/c18-16(19)17(20,21)28-12-4-2-1-3-11(12)23-14(25)9-6-5-8(15(26)27)7-10(9)13(22)24/h1-7,16H,(H2,22,24)(H,23,25)(H,26,27) |
| InChIKey | MTSUPAYSDLZOEH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|