C14H9ClF7N3O2 — CID 87474784
5-chloro-1-methyl-N-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 87474784) has the molecular formula C14H9ClF7N3O2 and a molecular weight of 419.68 g/mol. Its IUPAC name is 5-chloro-1-methyl-N-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 5-chloro-1-methyl-N-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 87474784 |
| Molecular Formula | C14H9ClF7N3O2 |
| Molecular Weight | 419.68 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | 5-chloro-1-methyl-N-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | Cn1nc(C(F)(F)F)c(C(=O)Nc2ccccc2OC(F)(F)C(F)F)c1Cl |
| InChI | InChI=1S/C14H9ClF7N3O2/c1-25-10(15)8(9(24-25)13(18,19)20)11(26)23-6-4-2-3-5-7(6)27-14(21,22)12(16)17/h2-5,12H,1H3,(H,23,26) |
| InChIKey | KLIMWUJOYXPKFZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.68 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|