C20H29N3O4 — CID 142113421
amino (2R)-2-[(E)-5-amino-6-oxo-6-phenylmethoxyhex-2-enyl]azepane-1-carboxylate (PubChem CID 142113421) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is amino (2R)-2-[(E)-5-amino-6-oxo-6-phenylmethoxyhex-2-enyl]azepane-1-carboxylate.
| Compound Name | amino (2R)-2-[(E)-5-amino-6-oxo-6-phenylmethoxyhex-2-enyl]azepane-1-carboxylate |
|---|---|
| PubChem CID | 142113421 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | amino (2R)-2-[(E)-5-amino-6-oxo-6-phenylmethoxyhex-2-enyl]azepane-1-carboxylate |
| SMILES | NOC(=O)N1CCCCC[C@@H]1C/C=C/CC(N)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H29N3O4/c21-18(19(24)26-15-16-9-3-1-4-10-16)13-7-6-12-17-11-5-2-8-14-23(17)20(25)27-22/h1,3-4,6-7,9-10,17-18H,2,5,8,11-15,21-22H2/b7-6+/t17-,18?/m1/s1 |
| InChIKey | ZXCKYNXWJLGDKS-MYLUPBJYSA-N |
| XLogP | 2.65 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|