C15H19N — CID 142114175
2,3,3,5-tetramethyl-4-[(Z)-prop-1-enyl]indole (PubChem CID 142114175) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 2,3,3,5-tetramethyl-4-[(Z)-prop-1-enyl]indole.
| Compound Name | 2,3,3,5-tetramethyl-4-[(Z)-prop-1-enyl]indole |
|---|---|
| PubChem CID | 142114175 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2,3,3,5-tetramethyl-4-[(Z)-prop-1-enyl]indole |
| SMILES | C/C=C\c1c(C)ccc2c1C(C)(C)C(C)=N2 |
| InChI | InChI=1S/C15H19N/c1-6-7-12-10(2)8-9-13-14(12)15(4,5)11(3)16-13/h6-9H,1-5H3/b7-6- |
| InChIKey | PPLJTRUNMIOGLD-SREVYHEPSA-N |
| XLogP | 4.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |