C10H8N2O2S — CID 142116929
4-(1,3-thiazol-5-yloxy)benzamide (PubChem CID 142116929) has the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. Its IUPAC name is 4-(1,3-thiazol-5-yloxy)benzamide.
| Compound Name | 4-(1,3-thiazol-5-yloxy)benzamide |
|---|---|
| PubChem CID | 142116929 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 4-(1,3-thiazol-5-yloxy)benzamide |
| SMILES | NC(=O)c1ccc(Oc2cncs2)cc1 |
| InChI | InChI=1S/C10H8N2O2S/c11-10(13)7-1-3-8(4-2-7)14-9-5-12-6-15-9/h1-6H,(H2,11,13) |
| InChIKey | HREWZMWDIRAQIO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |