methyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate

C10H8N2O3S — CID 91807661

IUPACmethyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate
SMILESCOC(=O)c1cncc(Oc2cncs2)c1
InChIInChI=1S/C10H8N2O3S/c1-14-10(13)7-2-8(4-11-3-7)15-9-5-12-6-16-9/h2-6H,1H3
InChIKeyICPXWCFJZCRYLW-UHFFFAOYSA-N
MW236.25 g/mol
LogP2.12
Rot. Bonds3

About methyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate

methyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate (PubChem CID 91807661) has the molecular formula C10H8N2O3S and a molecular weight of 236.25 g/mol. Its IUPAC name is methyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate.

Molecular Properties

Compound Namemethyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate
PubChem CID91807661
Molecular FormulaC10H8N2O3S
Molecular Weight236.25 g/mol
Exact Mass236.03
IUPAC Namemethyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate
SMILESCOC(=O)c1cncc(Oc2cncs2)c1
InChIInChI=1S/C10H8N2O3S/c1-14-10(13)7-2-8(4-11-3-7)15-9-5-12-6-16-9/h2-6H,1H3
InChIKeyICPXWCFJZCRYLW-UHFFFAOYSA-N
XLogP2.12
TPSA61.31 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.25
LogP ≤ 52.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate?
The IUPAC name of methyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate (CID 91807661) is methyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate.
What is the SMILES notation for methyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate?
The canonical SMILES for methyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate is COC(=O)c1cncc(Oc2cncs2)c1.
What is the InChIKey of methyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate?
The InChIKey is ICPXWCFJZCRYLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3S/c1-14-10(13)7-2-8(4-11-3-7)15-9-5-12-6-16-9/h2-6H,1H3.
What are the key properties of methyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate?
methyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate has a molecular weight of 236.25 g/mol, XLogP of 2.12, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate is sourced from PubChem (CID 91807661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).