C10H8N2O3S — CID 91807661
methyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate (PubChem CID 91807661) has the molecular formula C10H8N2O3S and a molecular weight of 236.25 g/mol. Its IUPAC name is methyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate.
| Compound Name | methyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 91807661 |
| Molecular Formula | C10H8N2O3S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | methyl 5-(1,3-thiazol-5-yloxy)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cncc(Oc2cncs2)c1 |
| InChI | InChI=1S/C10H8N2O3S/c1-14-10(13)7-2-8(4-11-3-7)15-9-5-12-6-16-9/h2-6H,1H3 |
| InChIKey | ICPXWCFJZCRYLW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |