C21H28N4OS — CID 142117587
2-(4-amino-3-methanimidoyl-2-sulfanylidene-1-pyridinyl)-N-heptyl-2-phenylacetamide (PubChem CID 142117587) has the molecular formula C21H28N4OS and a molecular weight of 384.55 g/mol. Its IUPAC name is 2-(4-amino-3-methanimidoyl-2-sulfanylidene-1-pyridinyl)-N-heptyl-2-phenylacetamide.
| Compound Name | 2-(4-amino-3-methanimidoyl-2-sulfanylidene-1-pyridinyl)-N-heptyl-2-phenylacetamide |
|---|---|
| PubChem CID | 142117587 |
| Molecular Formula | C21H28N4OS |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2-(4-amino-3-methanimidoyl-2-sulfanylidene-1-pyridinyl)-N-heptyl-2-phenylacetamide |
| SMILES | [H]/N=C/c1c(N)ccn(C(C(=O)NCCCCCCC)c2ccccc2)c1=S |
| InChI | InChI=1S/C21H28N4OS/c1-2-3-4-5-9-13-24-20(26)19(16-10-7-6-8-11-16)25-14-12-18(23)17(15-22)21(25)27/h6-8,10-12,14-15,19,22H,2-5,9,13,23H2,1H3,(H,24,26)/b22-15+ |
| InChIKey | GUEPOOBIXBXLKM-PXLXIMEGSA-N |
| XLogP | 4.47 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|