C23H36N4OS — CID 142117619
ethane;N-heptyl-2-(4-hydrazinyl-3-methyl-2-sulfanylidene-1-pyridinyl)-2-phenylacetamide (PubChem CID 142117619) has the molecular formula C23H36N4OS and a molecular weight of 416.64 g/mol. Its IUPAC name is ethane;N-heptyl-2-(4-hydrazinyl-3-methyl-2-sulfanylidene-1-pyridinyl)-2-phenylacetamide.
| Compound Name | ethane;N-heptyl-2-(4-hydrazinyl-3-methyl-2-sulfanylidene-1-pyridinyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 142117619 |
| Molecular Formula | C23H36N4OS |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | ethane;N-heptyl-2-(4-hydrazinyl-3-methyl-2-sulfanylidene-1-pyridinyl)-2-phenylacetamide |
| SMILES | CC.CCCCCCCNC(=O)C(c1ccccc1)n1ccc(NN)c(C)c1=S |
| InChI | InChI=1S/C21H30N4OS.C2H6/c1-3-4-5-6-10-14-23-20(26)19(17-11-8-7-9-12-17)25-15-13-18(24-22)16(2)21(25)27;1-2/h7-9,11-13,15,19,24H,3-6,10,14,22H2,1-2H3,(H,23,26);1-2H3 |
| InChIKey | MIYNEUNPOUWJNV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 72.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|