C25H26N4O7 — CID 1421177
1,5-diethyl-3,7-bis(3-nitrobenzoyl)-3,7-diazabicyclo[3.3.1]nonan-9-one (PubChem CID 1421177) has the molecular formula C25H26N4O7 and a molecular weight of 494.50 g/mol. Its IUPAC name is 1,5-diethyl-3,7-bis(3-nitrobenzoyl)-3,7-diazabicyclo[3.3.1]nonan-9-one.
| Compound Name | 1,5-diethyl-3,7-bis(3-nitrobenzoyl)-3,7-diazabicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 1421177 |
| Molecular Formula | C25H26N4O7 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 1,5-diethyl-3,7-bis(3-nitrobenzoyl)-3,7-diazabicyclo[3.3.1]nonan-9-one |
| SMILES | CCC12CN(C(=O)c3cccc([N+](=O)[O-])c3)CC(CC)(CN(C(=O)c3cccc([N+](=O)[O-])c3)C1)C2=O |
| InChI | InChI=1S/C25H26N4O7/c1-3-24-13-26(21(30)17-7-5-9-19(11-17)28(33)34)15-25(4-2,23(24)32)16-27(14-24)22(31)18-8-6-10-20(12-18)29(35)36/h5-12H,3-4,13-16H2,1-2H3 |
| InChIKey | OUKQHXYRYXUKDS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 143.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|