C25H39N — CID 142120798
2,2-dimethyl-1-[3-methyl-5-[(1Z,3Z,7E)-7-methylcycloocta-1,3,7-trien-1-yl]nona-7,8-dienyl]pyrrolidine (PubChem CID 142120798) has the molecular formula C25H39N and a molecular weight of 353.59 g/mol. Its IUPAC name is 2,2-dimethyl-1-[3-methyl-5-[(1Z,3Z,7E)-7-methylcycloocta-1,3,7-trien-1-yl]nona-7,8-dienyl]pyrrolidine.
| Compound Name | 2,2-dimethyl-1-[3-methyl-5-[(1Z,3Z,7E)-7-methylcycloocta-1,3,7-trien-1-yl]nona-7,8-dienyl]pyrrolidine |
|---|---|
| PubChem CID | 142120798 |
| Molecular Formula | C25H39N |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 353.31 |
| IUPAC Name | 2,2-dimethyl-1-[3-methyl-5-[(1Z,3Z,7E)-7-methylcycloocta-1,3,7-trien-1-yl]nona-7,8-dienyl]pyrrolidine |
| SMILES | C=C=CCC(CC(C)CCN1CCCC1(C)C)C1=C/C=C\CC/C(C)=C\1 |
| InChI | InChI=1S/C25H39N/c1-6-7-13-23(24-14-10-8-9-12-21(2)19-24)20-22(3)15-18-26-17-11-16-25(26,4)5/h7-8,10,14,19,22-23H,1,9,11-13,15-18,20H2,2-5H3/b10-8-,21-19-,24-14+ |
| InChIKey | CILHFOBTLASYDZ-DLPQRABKSA-N |
| XLogP | 6.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |