C16H27F2N — CID 142948092
(3R)-1-tert-butyl-3-[(5E)-3,5-difluoroocta-1,5-dien-2-yl]pyrrolidine (PubChem CID 142948092) has the molecular formula C16H27F2N and a molecular weight of 271.39 g/mol. Its IUPAC name is (3R)-1-tert-butyl-3-[(5E)-3,5-difluoroocta-1,5-dien-2-yl]pyrrolidine.
| Compound Name | (3R)-1-tert-butyl-3-[(5E)-3,5-difluoroocta-1,5-dien-2-yl]pyrrolidine |
|---|---|
| PubChem CID | 142948092 |
| Molecular Formula | C16H27F2N |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | (3R)-1-tert-butyl-3-[(5E)-3,5-difluoroocta-1,5-dien-2-yl]pyrrolidine |
| SMILES | C=C(C(F)C/C(F)=C\CC)[C@H]1CCN(C(C)(C)C)C1 |
| InChI | InChI=1S/C16H27F2N/c1-6-7-14(17)10-15(18)12(2)13-8-9-19(11-13)16(3,4)5/h7,13,15H,2,6,8-11H2,1,3-5H3/b14-7+/t13-,15?/m0/s1 |
| InChIKey | JJWRHJZMKDPQHL-WSJKNJTOSA-N |
| XLogP | 4.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|