C8H8N2O2 — CID 142123848
3-ethenyl-4-methanimidoyl-1-methylpyrrole-2,5-dione (PubChem CID 142123848) has the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. Its IUPAC name is 3-ethenyl-4-methanimidoyl-1-methylpyrrole-2,5-dione.
| Compound Name | 3-ethenyl-4-methanimidoyl-1-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 142123848 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 3-ethenyl-4-methanimidoyl-1-methylpyrrole-2,5-dione |
| SMILES | [H]/N=C/C1=C(C=C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C8H8N2O2/c1-3-5-6(4-9)8(12)10(2)7(5)11/h3-4,9H,1H2,2H3/b9-4+ |
| InChIKey | LHZFONVVSKOLAY-RUDMXATFSA-N |
| XLogP | 0.12 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|