C8H10N2O — CID 118287089
3-methanimidoyl-4-[(Z)-prop-1-enyl]-1,2-dihydropyrrol-5-one (PubChem CID 118287089) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 3-methanimidoyl-4-[(Z)-prop-1-enyl]-1,2-dihydropyrrol-5-one.
| Compound Name | 3-methanimidoyl-4-[(Z)-prop-1-enyl]-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 118287089 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 3-methanimidoyl-4-[(Z)-prop-1-enyl]-1,2-dihydropyrrol-5-one |
| SMILES | [H]/N=C/C1=C(/C=C\C)C(=O)NC1 |
| InChI | InChI=1S/C8H10N2O/c1-2-3-7-6(4-9)5-10-8(7)11/h2-4,9H,5H2,1H3,(H,10,11)/b3-2-,9-4+ |
| InChIKey | BNJKADSEEUNRFH-SEEXIRIMSA-N |
| XLogP | 0.64 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|