C14H18N2O2 — CID 142598979
1-[(2E,4Z)-4-methanimidoylhexa-2,4-dienoyl]-3,3-dimethyl-2H-pyridin-6-one (PubChem CID 142598979) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-[(2E,4Z)-4-methanimidoylhexa-2,4-dienoyl]-3,3-dimethyl-2H-pyridin-6-one.
| Compound Name | 1-[(2E,4Z)-4-methanimidoylhexa-2,4-dienoyl]-3,3-dimethyl-2H-pyridin-6-one |
|---|---|
| PubChem CID | 142598979 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-[(2E,4Z)-4-methanimidoylhexa-2,4-dienoyl]-3,3-dimethyl-2H-pyridin-6-one |
| SMILES | [H]/N=C/C(=C\C)/C=C/C(=O)N1CC(C)(C)C=CC1=O |
| InChI | InChI=1S/C14H18N2O2/c1-4-11(9-15)5-6-12(17)16-10-14(2,3)8-7-13(16)18/h4-9,15H,10H2,1-3H3/b6-5+,11-4-,15-9+ |
| InChIKey | ATFJDLHXSYBCGC-ROFFMIRESA-N |
| XLogP | 2.09 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|