C13H20N2O2 — CID 143838789
ethane;1-methyl-5-(methyliminomethyl)-4-[(Z)-prop-1-enyl]-3H-pyridine-2,6-dione (PubChem CID 143838789) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is ethane;1-methyl-5-(methyliminomethyl)-4-[(Z)-prop-1-enyl]-3H-pyridine-2,6-dione.
| Compound Name | ethane;1-methyl-5-(methyliminomethyl)-4-[(Z)-prop-1-enyl]-3H-pyridine-2,6-dione |
|---|---|
| PubChem CID | 143838789 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | ethane;1-methyl-5-(methyliminomethyl)-4-[(Z)-prop-1-enyl]-3H-pyridine-2,6-dione |
| SMILES | C/C=C\C1=C(/C=N/C)C(=O)N(C)C(=O)C1.CC |
| InChI | InChI=1S/C11H14N2O2.C2H6/c1-4-5-8-6-10(14)13(3)11(15)9(8)7-12-2;1-2/h4-5,7H,6H2,1-3H3;1-2H3/b5-4-,12-7+; |
| InChIKey | CCVUFILSLHOULU-KUIRYIATSA-N |
| XLogP | 1.97 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|