C13H22N2O — CID 143839053
ethane;1-methyl-5-(methyliminomethyl)-4-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-one (PubChem CID 143839053) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is ethane;1-methyl-5-(methyliminomethyl)-4-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-one.
| Compound Name | ethane;1-methyl-5-(methyliminomethyl)-4-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 143839053 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | ethane;1-methyl-5-(methyliminomethyl)-4-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-one |
| SMILES | C/C=C\C1=C(/C=N/C)C(=O)N(C)CC1.CC |
| InChI | InChI=1S/C11H16N2O.C2H6/c1-4-5-9-6-7-13(3)11(14)10(9)8-12-2;1-2/h4-5,8H,6-7H2,1-3H3;1-2H3/b5-4-,12-8+; |
| InChIKey | VNYHTSWJNOUYBB-OBKTYYTPSA-N |
| XLogP | 2.45 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|