C11H16N2O — CID 91432633
N,N-dimethyl-3-(3-methyl-2,3-dihydropyridin-5-yl)prop-2-enamide (PubChem CID 91432633) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is N,N-dimethyl-3-(3-methyl-2,3-dihydropyridin-5-yl)prop-2-enamide.
| Compound Name | N,N-dimethyl-3-(3-methyl-2,3-dihydropyridin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 91432633 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | N,N-dimethyl-3-(3-methyl-2,3-dihydropyridin-5-yl)prop-2-enamide |
| SMILES | CC1C=C(C=CC(=O)N(C)C)C=NC1 |
| InChI | InChI=1S/C11H16N2O/c1-9-6-10(8-12-7-9)4-5-11(14)13(2)3/h4-6,8-9H,7H2,1-3H3 |
| InChIKey | OHNUEVXUEGAAKK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|