C12H16N2O — CID 167522975
2,5-dimethyl-2,7-naphthyridin-3-one;ethane (PubChem CID 167522975) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 2,5-dimethyl-2,7-naphthyridin-3-one;ethane.
| Compound Name | 2,5-dimethyl-2,7-naphthyridin-3-one;ethane |
|---|---|
| PubChem CID | 167522975 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2,5-dimethyl-2,7-naphthyridin-3-one;ethane |
| SMILES | CC.Cc1cncc2cn(C)c(=O)cc12 |
| InChI | InChI=1S/C10H10N2O.C2H6/c1-7-4-11-5-8-6-12(2)10(13)3-9(7)8;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | YKSYBHHYUJTLEE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |