C15H26N2O — CID 167523014
ethane;2-methyl-2,7-naphthyridin-3-one (PubChem CID 167523014) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is ethane;2-methyl-2,7-naphthyridin-3-one.
| Compound Name | ethane;2-methyl-2,7-naphthyridin-3-one |
|---|---|
| PubChem CID | 167523014 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | ethane;2-methyl-2,7-naphthyridin-3-one |
| SMILES | CC.CC.CC.Cn1cc2cnccc2cc1=O |
| InChI | InChI=1S/C9H8N2O.3C2H6/c1-11-6-8-5-10-3-2-7(8)4-9(11)12;3*1-2/h2-6H,1H3;3*1-2H3 |
| InChIKey | YIBLZBFSHYNCIP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |