C10H14N2O — CID 90845381
3-(2,3-dihydropyridin-5-yl)-N,N-dimethylprop-2-enamide (PubChem CID 90845381) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 3-(2,3-dihydropyridin-5-yl)-N,N-dimethylprop-2-enamide.
| Compound Name | 3-(2,3-dihydropyridin-5-yl)-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 90845381 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 3-(2,3-dihydropyridin-5-yl)-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)C=CC1=CCCN=C1 |
| InChI | InChI=1S/C10H14N2O/c1-12(2)10(13)6-5-9-4-3-7-11-8-9/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | ZIRBYUJLWORMKO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|