C9H12N2O — CID 123207508
1,6-dimethyl-5-(methyliminomethyl)pyridin-2-one (PubChem CID 123207508) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 1,6-dimethyl-5-(methyliminomethyl)pyridin-2-one.
| Compound Name | 1,6-dimethyl-5-(methyliminomethyl)pyridin-2-one |
|---|---|
| PubChem CID | 123207508 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 1,6-dimethyl-5-(methyliminomethyl)pyridin-2-one |
| SMILES | C/N=C/c1ccc(=O)n(C)c1C |
| InChI | InChI=1S/C9H12N2O/c1-7-8(6-10-2)4-5-9(12)11(7)3/h4-6H,1-3H3/b10-6+ |
| InChIKey | NTMXMOUXJRFYMF-UXBLZVDNSA-N |
| XLogP | 0.74 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|