About ethane;1-methyl-5H-1,6-naphthyridin-5-id-2-one;ruthenium(1+)
ethane;1-methyl-5H-1,6-naphthyridin-5-id-2-one;ruthenium(1+) (PubChem CID 170592021) has the molecular formula C11H13N2ORu
and a molecular weight of 290.31 g/mol. Its IUPAC name is ethane;1-methyl-5H-1,6-naphthyridin-5-id-2-one;ruthenium(1+).
Molecular Properties
| Compound Name | ethane;1-methyl-5H-1,6-naphthyridin-5-id-2-one;ruthenium(1+) |
| PubChem CID | 170592021 |
| Molecular Formula | C11H13N2ORu |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | ethane;1-methyl-5H-1,6-naphthyridin-5-id-2-one;ruthenium(1+) |
| SMILES | CC.Cn1c(=O)ccc2[c-]nccc21.[Ru+] |
| InChI | InChI=1S/C9H7N2O.C2H6.Ru/c1-11-8-4-5-10-6-7(8)2-3-9(11)12;1-2;/h2-5H,1H3;1-2H3;/q-1;;+1 |
| InChIKey | KSMHKDHGUMSWFI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methyl-5H-1,6-naphthyridin-5-id-2-one;ruthenium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-5H-1,6-naphthyridin-5-id-2-one;ruthenium(1+)?
The IUPAC name of ethane;1-methyl-5H-1,6-naphthyridin-5-id-2-one;ruthenium(1+) (CID 170592021) is ethane;1-methyl-5H-1,6-naphthyridin-5-id-2-one;ruthenium(1+).
What is the SMILES notation for ethane;1-methyl-5H-1,6-naphthyridin-5-id-2-one;ruthenium(1+)?
The canonical SMILES for ethane;1-methyl-5H-1,6-naphthyridin-5-id-2-one;ruthenium(1+) is CC.Cn1c(=O)ccc2[c-]nccc21.[Ru+].
What is the InChIKey of ethane;1-methyl-5H-1,6-naphthyridin-5-id-2-one;ruthenium(1+)?
The InChIKey is KSMHKDHGUMSWFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N2O.C2H6.Ru/c1-11-8-4-5-10-6-7(8)2-3-9(11)12;1-2;/h2-5H,1H3;1-2H3;/q-1;;+1.
What are the key properties of ethane;1-methyl-5H-1,6-naphthyridin-5-id-2-one;ruthenium(1+)?
ethane;1-methyl-5H-1,6-naphthyridin-5-id-2-one;ruthenium(1+) has a molecular weight of 290.31 g/mol, XLogP of 1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-5H-1,6-naphthyridin-5-id-2-one;ruthenium(1+) is sourced from PubChem (CID 170592021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).