C11H14N2O — CID 143019342
1-(1,3,4,7-tetrahydropyrido[3,4-c]azepin-2-yl)ethanone (PubChem CID 143019342) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-(1,3,4,7-tetrahydropyrido[3,4-c]azepin-2-yl)ethanone.
| Compound Name | 1-(1,3,4,7-tetrahydropyrido[3,4-c]azepin-2-yl)ethanone |
|---|---|
| PubChem CID | 143019342 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1-(1,3,4,7-tetrahydropyrido[3,4-c]azepin-2-yl)ethanone |
| SMILES | CC(=O)N1CCC2=C(C=NCC=C2)C1 |
| InChI | InChI=1S/C11H14N2O/c1-9(14)13-6-4-10-3-2-5-12-7-11(10)8-13/h2-3,7H,4-6,8H2,1H3 |
| InChIKey | PJZAUCWGSSRHSG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |