C14H22N2O — CID 163274686
4,7-dimethyl-1,7-naphthyridin-6-one;ethane (PubChem CID 163274686) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 4,7-dimethyl-1,7-naphthyridin-6-one;ethane.
| Compound Name | 4,7-dimethyl-1,7-naphthyridin-6-one;ethane |
|---|---|
| PubChem CID | 163274686 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 4,7-dimethyl-1,7-naphthyridin-6-one;ethane |
| SMILES | CC.CC.Cc1ccnc2cn(C)c(=O)cc12 |
| InChI | InChI=1S/C10H10N2O.2C2H6/c1-7-3-4-11-9-6-12(2)10(13)5-8(7)9;2*1-2/h3-6H,1-2H3;2*1-2H3 |
| InChIKey | GLTKFPLCSBYOMU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |