C14H19N2O2+ — CID 159185875
1,4-dimethyl-3H-pyridin-1-ium-2-one;1,6-dimethylpyridin-2-one (PubChem CID 159185875) has the molecular formula C14H19N2O2+ and a molecular weight of 247.32 g/mol. Its IUPAC name is 1,4-dimethyl-3H-pyridin-1-ium-2-one;1,6-dimethylpyridin-2-one.
| Compound Name | 1,4-dimethyl-3H-pyridin-1-ium-2-one;1,6-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 159185875 |
| Molecular Formula | C14H19N2O2+ |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 1,4-dimethyl-3H-pyridin-1-ium-2-one;1,6-dimethylpyridin-2-one |
| SMILES | CC1=CC=[N+](C)C(=O)C1.Cc1cccc(=O)n1C |
| InChI | InChI=1S/C7H10NO.C7H9NO/c1-6-3-4-8(2)7(9)5-6;1-6-4-3-5-7(9)8(6)2/h3-4H,5H2,1-2H3;3-5H,1-2H3/q+1; |
| InChIKey | XHPMKLAQDLOWDH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 42.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|