C15H20N2O — CID 123378105
1-ethyl-3,5,7-trimethyl-9,10-dihydropyrido[3,2-c]azocin-2-one (PubChem CID 123378105) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 1-ethyl-3,5,7-trimethyl-9,10-dihydropyrido[3,2-c]azocin-2-one.
| Compound Name | 1-ethyl-3,5,7-trimethyl-9,10-dihydropyrido[3,2-c]azocin-2-one |
|---|---|
| PubChem CID | 123378105 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 1-ethyl-3,5,7-trimethyl-9,10-dihydropyrido[3,2-c]azocin-2-one |
| SMILES | CCn1c2c(cc(C)c1=O)/C(C)=N\C(C)=CCC2 |
| InChI | InChI=1S/C15H20N2O/c1-5-17-14-8-6-7-11(3)16-12(4)13(14)9-10(2)15(17)18/h7,9H,5-6,8H2,1-4H3/b11-7?,16-12- |
| InChIKey | FGZDIPFCDKMPBY-KIUXLTJGSA-N |
| XLogP | 2.84 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |