C16H22N2O — CID 176707488
4-[(E)-1-[[(Z)-but-2-enylidene]amino]pent-1-enyl]-1,3-dimethylpyridin-2-one (PubChem CID 176707488) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 4-[(E)-1-[[(Z)-but-2-enylidene]amino]pent-1-enyl]-1,3-dimethylpyridin-2-one.
| Compound Name | 4-[(E)-1-[[(Z)-but-2-enylidene]amino]pent-1-enyl]-1,3-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 176707488 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 4-[(E)-1-[[(Z)-but-2-enylidene]amino]pent-1-enyl]-1,3-dimethylpyridin-2-one |
| SMILES | C/C=C\C=N\C(=C\CCC)c1ccn(C)c(=O)c1C |
| InChI | InChI=1S/C16H22N2O/c1-5-7-9-15(17-11-8-6-2)14-10-12-18(4)16(19)13(14)3/h6,8-12H,5,7H2,1-4H3/b8-6-,15-9+,17-11+ |
| InChIKey | VZOUMKOHNLWQEX-WXHNZAHZSA-N |
| XLogP | 3.48 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|