C32H32N4O4 — CID 142124096
2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]cyclohexa-1,3-dien-5-yn-1-yl]methyl-[2-(1H-indol-3-yl)ethyl]amino]ethyl 3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 142124096) has the molecular formula C32H32N4O4 and a molecular weight of 536.63 g/mol. Its IUPAC name is 2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]cyclohexa-1,3-dien-5-yn-1-yl]methyl-[2-(1H-indol-3-yl)ethyl]amino]ethyl 3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | 2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]cyclohexa-1,3-dien-5-yn-1-yl]methyl-[2-(1H-indol-3-yl)ethyl]amino]ethyl 3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 142124096 |
| Molecular Formula | C32H32N4O4 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | 2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]cyclohexa-1,3-dien-5-yn-1-yl]methyl-[2-(1H-indol-3-yl)ethyl]amino]ethyl 3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | O=C(/C=C/c1c#cc(CN(CCOC(=O)N2CCc3ccccc3C2)CCc2c[nH]c3ccccc23)cc1)NO |
| InChI | InChI=1S/C32H32N4O4/c37-31(34-39)14-13-24-9-11-25(12-10-24)22-35(17-15-27-21-33-30-8-4-3-7-29(27)30)19-20-40-32(38)36-18-16-26-5-1-2-6-28(26)23-36/h1-9,11,13-14,21,33,39H,15-20,22-23H2,(H,34,37)/b14-13+ |
| InChIKey | MWTKCNJQIHEMHK-BUHFOSPRSA-N |
| XLogP | 4.53 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|