C14H23N3 — CID 142126179
N,2-dimethyl-1,7-naphthyridin-4-amine;ethane (PubChem CID 142126179) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is N,2-dimethyl-1,7-naphthyridin-4-amine;ethane.
| Compound Name | N,2-dimethyl-1,7-naphthyridin-4-amine;ethane |
|---|---|
| PubChem CID | 142126179 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | N,2-dimethyl-1,7-naphthyridin-4-amine;ethane |
| SMILES | CC.CC.CNc1cc(C)nc2cnccc12 |
| InChI | InChI=1S/C10H11N3.2C2H6/c1-7-5-9(11-2)8-3-4-12-6-10(8)13-7;2*1-2/h3-6H,1-2H3,(H,11,13);2*1-2H3 |
| InChIKey | DYPIPQNCHLMFHH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |