C25H27F3N4O — CID 142126246
(3Z)-2-N-[8-ethyl-2-[2-(trifluoromethoxy)phenyl]quinazolin-4-yl]-4-N-propylpenta-1,3-diene-2,4-diamine (PubChem CID 142126246) has the molecular formula C25H27F3N4O and a molecular weight of 456.51 g/mol. Its IUPAC name is (3Z)-2-N-[8-ethyl-2-[2-(trifluoromethoxy)phenyl]quinazolin-4-yl]-4-N-propylpenta-1,3-diene-2,4-diamine.
| Compound Name | (3Z)-2-N-[8-ethyl-2-[2-(trifluoromethoxy)phenyl]quinazolin-4-yl]-4-N-propylpenta-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 142126246 |
| Molecular Formula | C25H27F3N4O |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | (3Z)-2-N-[8-ethyl-2-[2-(trifluoromethoxy)phenyl]quinazolin-4-yl]-4-N-propylpenta-1,3-diene-2,4-diamine |
| SMILES | C=C(/C=C(/C)NCCC)Nc1nc(-c2ccccc2OC(F)(F)F)nc2c(CC)cccc12 |
| InChI | InChI=1S/C25H27F3N4O/c1-5-14-29-16(3)15-17(4)30-24-20-12-9-10-18(6-2)22(20)31-23(32-24)19-11-7-8-13-21(19)33-25(26,27)28/h7-13,15,29H,4-6,14H2,1-3H3,(H,30,31,32)/b16-15- |
| InChIKey | HIYAKJGHBWAOFV-NXVVXOECSA-N |
| XLogP | 6.59 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|